C13H12F3N — CID 62790893
3,3,3-trifluoro-1-naphthalen-1-ylpropan-1-amine (PubChem CID 62790893) has the molecular formula C13H12F3N and a molecular weight of 239.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-naphthalen-1-ylpropan-1-amine.
| Compound Name | 3,3,3-trifluoro-1-naphthalen-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 62790893 |
| Molecular Formula | C13H12F3N |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 3,3,3-trifluoro-1-naphthalen-1-ylpropan-1-amine |
| SMILES | NC(CC(F)(F)F)c1cccc2ccccc12 |
| InChI | InChI=1S/C13H12F3N/c14-13(15,16)8-12(17)11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12H,8,17H2 |
| InChIKey | KMVOMNRLMVKMGN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |