C9H9BrF3N — CID 97290639
(1R)-1-(2-bromophenyl)-3,3,3-trifluoropropan-1-amine (PubChem CID 97290639) has the molecular formula C9H9BrF3N and a molecular weight of 268.08 g/mol. Its IUPAC name is (1R)-1-(2-bromophenyl)-3,3,3-trifluoropropan-1-amine.
| Compound Name | (1R)-1-(2-bromophenyl)-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 97290639 |
| Molecular Formula | C9H9BrF3N |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | (1R)-1-(2-bromophenyl)-3,3,3-trifluoropropan-1-amine |
| SMILES | N[C@H](CC(F)(F)F)c1ccccc1Br |
| InChI | InChI=1S/C9H9BrF3N/c10-7-4-2-1-3-6(7)8(14)5-9(11,12)13/h1-4,8H,5,14H2/t8-/m1/s1 |
| InChIKey | VTTCARHACAQRDT-MRVPVSSYSA-N |
| XLogP | 3.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |