C9H8Cl2F3N — CID 103693902
(1S)-1-(2,3-dichlorophenyl)-3,3,3-trifluoropropan-1-amine (PubChem CID 103693902) has the molecular formula C9H8Cl2F3N and a molecular weight of 258.07 g/mol. Its IUPAC name is (1S)-1-(2,3-dichlorophenyl)-3,3,3-trifluoropropan-1-amine.
| Compound Name | (1S)-1-(2,3-dichlorophenyl)-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 103693902 |
| Molecular Formula | C9H8Cl2F3N |
| Molecular Weight | 258.07 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | (1S)-1-(2,3-dichlorophenyl)-3,3,3-trifluoropropan-1-amine |
| SMILES | N[C@@H](CC(F)(F)F)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H8Cl2F3N/c10-6-3-1-2-5(8(6)11)7(15)4-9(12,13)14/h1-3,7H,4,15H2/t7-/m0/s1 |
| InChIKey | YDCTUKUWBRBXOA-ZETCQYMHSA-N |
| XLogP | 3.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.07 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |