C9H9Cl2NO — CID 123893980
3-amino-3-(2,3-dichlorophenyl)propanal (PubChem CID 123893980) has the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. Its IUPAC name is 3-amino-3-(2,3-dichlorophenyl)propanal.
| Compound Name | 3-amino-3-(2,3-dichlorophenyl)propanal |
|---|---|
| PubChem CID | 123893980 |
| Molecular Formula | C9H9Cl2NO |
| Molecular Weight | 218.08 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 3-amino-3-(2,3-dichlorophenyl)propanal |
| SMILES | NC(CC=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H9Cl2NO/c10-7-3-1-2-6(9(7)11)8(12)4-5-13/h1-3,5,8H,4,12H2 |
| InChIKey | LUVAWGNHYVPDJT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.08 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|