C11H15Cl2N — CID 171204538
(1R)-1-(2,3-dichlorophenyl)pentan-1-amine (PubChem CID 171204538) has the molecular formula C11H15Cl2N and a molecular weight of 232.15 g/mol. Its IUPAC name is (1R)-1-(2,3-dichlorophenyl)pentan-1-amine.
| Compound Name | (1R)-1-(2,3-dichlorophenyl)pentan-1-amine |
|---|---|
| PubChem CID | 171204538 |
| Molecular Formula | C11H15Cl2N |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | (1R)-1-(2,3-dichlorophenyl)pentan-1-amine |
| SMILES | CCCC[C@@H](N)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H15Cl2N/c1-2-3-7-10(14)8-5-4-6-9(12)11(8)13/h4-6,10H,2-3,7,14H2,1H3/t10-/m1/s1 |
| InChIKey | ICEZQNUSGPUHFE-SNVBAGLBSA-N |
| XLogP | 4.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |