C17H27Cl2N — CID 115846022
1-(2,3-dichlorophenyl)undecan-1-amine (PubChem CID 115846022) has the molecular formula C17H27Cl2N and a molecular weight of 316.32 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)undecan-1-amine.
| Compound Name | 1-(2,3-dichlorophenyl)undecan-1-amine |
|---|---|
| PubChem CID | 115846022 |
| Molecular Formula | C17H27Cl2N |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-(2,3-dichlorophenyl)undecan-1-amine |
| SMILES | CCCCCCCCCCC(N)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H27Cl2N/c1-2-3-4-5-6-7-8-9-13-16(20)14-11-10-12-15(18)17(14)19/h10-12,16H,2-9,13,20H2,1H3 |
| InChIKey | VTFJMYHUJHINAO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|