C11H15Cl2NO2S — CID 115820999
1-(2,3-dichlorophenyl)-4-methylsulfonylbutan-1-amine (PubChem CID 115820999) has the molecular formula C11H15Cl2NO2S and a molecular weight of 296.22 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-4-methylsulfonylbutan-1-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-4-methylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 115820999 |
| Molecular Formula | C11H15Cl2NO2S |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-4-methylsulfonylbutan-1-amine |
| SMILES | CS(=O)(=O)CCCC(N)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H15Cl2NO2S/c1-17(15,16)7-3-6-10(14)8-4-2-5-9(12)11(8)13/h2,4-5,10H,3,6-7,14H2,1H3 |
| InChIKey | RSSQRTBPMLLXAI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |