C10H14Cl2N2OS — CID 130349740
N-[2-amino-2-(2,3-dichlorophenyl)ethyl]ethanesulfinamide (PubChem CID 130349740) has the molecular formula C10H14Cl2N2OS and a molecular weight of 281.21 g/mol. Its IUPAC name is N-[2-amino-2-(2,3-dichlorophenyl)ethyl]ethanesulfinamide.
| Compound Name | N-[2-amino-2-(2,3-dichlorophenyl)ethyl]ethanesulfinamide |
|---|---|
| PubChem CID | 130349740 |
| Molecular Formula | C10H14Cl2N2OS |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | N-[2-amino-2-(2,3-dichlorophenyl)ethyl]ethanesulfinamide |
| SMILES | CCS(=O)NCC(N)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H14Cl2N2OS/c1-2-16(15)14-6-9(13)7-4-3-5-8(11)10(7)12/h3-5,9,14H,2,6,13H2,1H3 |
| InChIKey | DWTXDEOHIGMEKN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |