C8H9Cl3N- — CID 51371192
1-(2,3-dichlorophenyl)ethanamine chloride (PubChem CID 51371192) has the molecular formula C8H9Cl3N- and a molecular weight of 225.53 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)ethanamine chloride.
| Compound Name | 1-(2,3-dichlorophenyl)ethanamine chloride |
|---|---|
| PubChem CID | 51371192 |
| Molecular Formula | C8H9Cl3N- |
| Molecular Weight | 225.53 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | 1-(2,3-dichlorophenyl)ethanamine chloride |
| SMILES | CC(N)c1cccc(Cl)c1Cl.[Cl-] |
| InChI | InChI=1S/C8H9Cl2N.ClH/c1-5(11)6-3-2-4-7(9)8(6)10;/h2-5H,11H2,1H3;1H/p-1 |
| InChIKey | FQTXPVLCCDQRHY-UHFFFAOYSA-M |
| XLogP | 0.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.53 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |