1-(2,3-dichlorophenyl)ethanamine chloride

C8H9Cl3N- — CID 51371192

IUPAC1-(2,3-dichlorophenyl)ethanamine chloride
SMILESCC(N)c1cccc(Cl)c1Cl.[Cl-]
InChIInChI=1S/C8H9Cl2N.ClH/c1-5(11)6-3-2-4-7(9)8(6)10;/h2-5H,11H2,1H3;1H/p-1
InChIKeyFQTXPVLCCDQRHY-UHFFFAOYSA-M
MW225.53 g/mol
LogP0.02
Rot. Bonds1

About 1-(2,3-dichlorophenyl)ethanamine chloride

1-(2,3-dichlorophenyl)ethanamine chloride (PubChem CID 51371192) has the molecular formula C8H9Cl3N- and a molecular weight of 225.53 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)ethanamine chloride.

Molecular Properties

Compound Name1-(2,3-dichlorophenyl)ethanamine chloride
PubChem CID51371192
Molecular FormulaC8H9Cl3N-
Molecular Weight225.53 g/mol
Exact Mass223.98
IUPAC Name1-(2,3-dichlorophenyl)ethanamine chloride
SMILESCC(N)c1cccc(Cl)c1Cl.[Cl-]
InChIInChI=1S/C8H9Cl2N.ClH/c1-5(11)6-3-2-4-7(9)8(6)10;/h2-5H,11H2,1H3;1H/p-1
InChIKeyFQTXPVLCCDQRHY-UHFFFAOYSA-M
XLogP0.02
TPSA26.02 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.53
LogP ≤ 50.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 1-(2,3-dichlorophenyl)ethanamine chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,3-dichlorophenyl)ethanamine chloride?
The IUPAC name of 1-(2,3-dichlorophenyl)ethanamine chloride (CID 51371192) is 1-(2,3-dichlorophenyl)ethanamine chloride.
What is the SMILES notation for 1-(2,3-dichlorophenyl)ethanamine chloride?
The canonical SMILES for 1-(2,3-dichlorophenyl)ethanamine chloride is CC(N)c1cccc(Cl)c1Cl.[Cl-].
What is the InChIKey of 1-(2,3-dichlorophenyl)ethanamine chloride?
The InChIKey is FQTXPVLCCDQRHY-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9Cl2N.ClH/c1-5(11)6-3-2-4-7(9)8(6)10;/h2-5H,11H2,1H3;1H/p-1.
What are the key properties of 1-(2,3-dichlorophenyl)ethanamine chloride?
1-(2,3-dichlorophenyl)ethanamine chloride has a molecular weight of 225.53 g/mol, XLogP of 0.02, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dichlorophenyl)ethanamine chloride is sourced from PubChem (CID 51371192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).