C9H7Cl2N — CID 69268424
2-(2,3-dichlorophenyl)propanenitrile (PubChem CID 69268424) has the molecular formula C9H7Cl2N and a molecular weight of 200.07 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)propanenitrile.
| Compound Name | 2-(2,3-dichlorophenyl)propanenitrile |
|---|---|
| PubChem CID | 69268424 |
| Molecular Formula | C9H7Cl2N |
| Molecular Weight | 200.07 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 2-(2,3-dichlorophenyl)propanenitrile |
| SMILES | CC(C#N)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H7Cl2N/c1-6(5-12)7-3-2-4-8(10)9(7)11/h2-4,6H,1H3 |
| InChIKey | HDVNXDGHMJSIEW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.07 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |