C10H9Cl2N — CID 83639930
3-(2,3-dichlorophenyl)butanenitrile (PubChem CID 83639930) has the molecular formula C10H9Cl2N and a molecular weight of 214.09 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)butanenitrile.
| Compound Name | 3-(2,3-dichlorophenyl)butanenitrile |
|---|---|
| PubChem CID | 83639930 |
| Molecular Formula | C10H9Cl2N |
| Molecular Weight | 214.09 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 3-(2,3-dichlorophenyl)butanenitrile |
| SMILES | CC(CC#N)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H9Cl2N/c1-7(5-6-13)8-3-2-4-9(11)10(8)12/h2-4,7H,5H2,1H3 |
| InChIKey | JCXBDIGISRHIOB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.09 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |