C12H15Cl2N — CID 145081047
3-(2,4-dichlorophenyl)butanenitrile;ethane (PubChem CID 145081047) has the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)butanenitrile;ethane.
| Compound Name | 3-(2,4-dichlorophenyl)butanenitrile;ethane |
|---|---|
| PubChem CID | 145081047 |
| Molecular Formula | C12H15Cl2N |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 3-(2,4-dichlorophenyl)butanenitrile;ethane |
| SMILES | CC.CC(CC#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl2N.C2H6/c1-7(4-5-13)9-3-2-8(11)6-10(9)12;1-2/h2-3,6-7H,4H2,1H3;1-2H3 |
| InChIKey | FAAJUEREYALLMS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |