C9H7Cl2N — CID 3974508
2,4-dichloro-1-(1-isocyanoethyl)benzene (PubChem CID 3974508) has the molecular formula C9H7Cl2N and a molecular weight of 200.07 g/mol. Its IUPAC name is 2,4-dichloro-1-(1-isocyanoethyl)benzene.
| Compound Name | 2,4-dichloro-1-(1-isocyanoethyl)benzene |
|---|---|
| PubChem CID | 3974508 |
| Molecular Formula | C9H7Cl2N |
| Molecular Weight | 200.07 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 2,4-dichloro-1-(1-isocyanoethyl)benzene |
| SMILES | [C-]#[N+]C(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H7Cl2N/c1-6(12-2)8-4-3-7(10)5-9(8)11/h3-6H,1H3 |
| InChIKey | BLTYYKHUXYZBHC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.07 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|