C12H21Cl2N — CID 142953133
1-(2,4-dichlorophenyl)ethanamine;ethane (PubChem CID 142953133) has the molecular formula C12H21Cl2N and a molecular weight of 250.21 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)ethanamine;ethane.
| Compound Name | 1-(2,4-dichlorophenyl)ethanamine;ethane |
|---|---|
| PubChem CID | 142953133 |
| Molecular Formula | C12H21Cl2N |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1-(2,4-dichlorophenyl)ethanamine;ethane |
| SMILES | CC.CC.CC(N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H9Cl2N.2C2H6/c1-5(11)7-3-2-6(9)4-8(7)10;2*1-2/h2-5H,11H2,1H3;2*1-2H3 |
| InChIKey | PVJQANOQWWLHBD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |