C12H18Cl3N — CID 171212560
(1R)-1-(2,4-dichlorophenyl)-4-methylpentan-1-amine;hydrochloride (PubChem CID 171212560) has the molecular formula C12H18Cl3N and a molecular weight of 282.64 g/mol. Its IUPAC name is (1R)-1-(2,4-dichlorophenyl)-4-methylpentan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2,4-dichlorophenyl)-4-methylpentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171212560 |
| Molecular Formula | C12H18Cl3N |
| Molecular Weight | 282.64 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | (1R)-1-(2,4-dichlorophenyl)-4-methylpentan-1-amine;hydrochloride |
| SMILES | CC(C)CC[C@@H](N)c1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C12H17Cl2N.ClH/c1-8(2)3-6-12(15)10-5-4-9(13)7-11(10)14;/h4-5,7-8,12H,3,6,15H2,1-2H3;1H/t12-;/m1./s1 |
| InChIKey | UDDMBQPCZPHLMF-UTONKHPSSA-N |
| XLogP | 4.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |