C10H14Cl3N — CID 171232141
(1S)-1-(2,4-dichlorophenyl)butan-1-amine;hydrochloride (PubChem CID 171232141) has the molecular formula C10H14Cl3N and a molecular weight of 254.59 g/mol. Its IUPAC name is (1S)-1-(2,4-dichlorophenyl)butan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2,4-dichlorophenyl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171232141 |
| Molecular Formula | C10H14Cl3N |
| Molecular Weight | 254.59 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | (1S)-1-(2,4-dichlorophenyl)butan-1-amine;hydrochloride |
| SMILES | CCC[C@H](N)c1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C10H13Cl2N.ClH/c1-2-3-10(13)8-5-4-7(11)6-9(8)12;/h4-6,10H,2-3,13H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | VPITZHYAJHPFKE-PPHPATTJSA-N |
| XLogP | 4.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |