C10H12Cl3N — CID 82550973
1-(2,3,4-trichlorophenyl)butan-1-amine (PubChem CID 82550973) has the molecular formula C10H12Cl3N and a molecular weight of 252.57 g/mol. Its IUPAC name is 1-(2,3,4-trichlorophenyl)butan-1-amine.
| Compound Name | 1-(2,3,4-trichlorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 82550973 |
| Molecular Formula | C10H12Cl3N |
| Molecular Weight | 252.57 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 1-(2,3,4-trichlorophenyl)butan-1-amine |
| SMILES | CCCC(N)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C10H12Cl3N/c1-2-3-8(14)6-4-5-7(11)10(13)9(6)12/h4-5,8H,2-3,14H2,1H3 |
| InChIKey | CAPHFCOIEFNGEP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|