C12H19Cl2NO2 — CID 171221538
(1S)-1-(2-chloro-3,4-dimethoxyphenyl)butan-1-amine;hydrochloride (PubChem CID 171221538) has the molecular formula C12H19Cl2NO2 and a molecular weight of 280.19 g/mol. Its IUPAC name is (1S)-1-(2-chloro-3,4-dimethoxyphenyl)butan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2-chloro-3,4-dimethoxyphenyl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171221538 |
| Molecular Formula | C12H19Cl2NO2 |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | (1S)-1-(2-chloro-3,4-dimethoxyphenyl)butan-1-amine;hydrochloride |
| SMILES | CCC[C@H](N)c1ccc(OC)c(OC)c1Cl.Cl |
| InChI | InChI=1S/C12H18ClNO2.ClH/c1-4-5-9(14)8-6-7-10(15-2)12(16-3)11(8)13;/h6-7,9H,4-5,14H2,1-3H3;1H/t9-;/m0./s1 |
| InChIKey | OSTXFFQTXGMELK-FVGYRXGTSA-N |
| XLogP | 3.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |