C13H22Cl2N2O2 — CID 171221531
(1S)-1-(2-chloro-3,4-dimethoxyphenyl)pentane-1,5-diamine;hydrochloride (PubChem CID 171221531) has the molecular formula C13H22Cl2N2O2 and a molecular weight of 309.24 g/mol. Its IUPAC name is (1S)-1-(2-chloro-3,4-dimethoxyphenyl)pentane-1,5-diamine;hydrochloride.
| Compound Name | (1S)-1-(2-chloro-3,4-dimethoxyphenyl)pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171221531 |
| Molecular Formula | C13H22Cl2N2O2 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (1S)-1-(2-chloro-3,4-dimethoxyphenyl)pentane-1,5-diamine;hydrochloride |
| SMILES | COc1ccc([C@@H](N)CCCCN)c(Cl)c1OC.Cl |
| InChI | InChI=1S/C13H21ClN2O2.ClH/c1-17-11-7-6-9(12(14)13(11)18-2)10(16)5-3-4-8-15;/h6-7,10H,3-5,8,15-16H2,1-2H3;1H/t10-;/m0./s1 |
| InChIKey | HUUIQGCJISWBAJ-PPHPATTJSA-N |
| XLogP | 2.91 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|