C10H13Cl2NOS — CID 116831304
3-amino-3-(2,3-dichloro-4-methoxyphenyl)propane-1-thiol (PubChem CID 116831304) has the molecular formula C10H13Cl2NOS and a molecular weight of 266.19 g/mol. Its IUPAC name is 3-amino-3-(2,3-dichloro-4-methoxyphenyl)propane-1-thiol.
| Compound Name | 3-amino-3-(2,3-dichloro-4-methoxyphenyl)propane-1-thiol |
|---|---|
| PubChem CID | 116831304 |
| Molecular Formula | C10H13Cl2NOS |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 3-amino-3-(2,3-dichloro-4-methoxyphenyl)propane-1-thiol |
| SMILES | COc1ccc(C(N)CCS)c(Cl)c1Cl |
| InChI | InChI=1S/C10H13Cl2NOS/c1-14-8-3-2-6(7(13)4-5-15)9(11)10(8)12/h2-3,7,15H,4-5,13H2,1H3 |
| InChIKey | VITUXTIOMGHEKM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|