C10H13Cl2NO2 — CID 116937817
3-amino-3-(2,3-dichloro-4-methoxyphenyl)propan-1-ol (PubChem CID 116937817) has the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. Its IUPAC name is 3-amino-3-(2,3-dichloro-4-methoxyphenyl)propan-1-ol.
| Compound Name | 3-amino-3-(2,3-dichloro-4-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 116937817 |
| Molecular Formula | C10H13Cl2NO2 |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 3-amino-3-(2,3-dichloro-4-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(C(N)CCO)c(Cl)c1Cl |
| InChI | InChI=1S/C10H13Cl2NO2/c1-15-8-3-2-6(7(13)4-5-14)9(11)10(8)12/h2-3,7,14H,4-5,13H2,1H3 |
| InChIKey | BSIQWDUUFNPJKD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |