C10H13Cl2NOS — CID 116830340
1-(2,3-dichloro-4-methoxyphenyl)-2-methylsulfanylethanamine (PubChem CID 116830340) has the molecular formula C10H13Cl2NOS and a molecular weight of 266.19 g/mol. Its IUPAC name is 1-(2,3-dichloro-4-methoxyphenyl)-2-methylsulfanylethanamine.
| Compound Name | 1-(2,3-dichloro-4-methoxyphenyl)-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 116830340 |
| Molecular Formula | C10H13Cl2NOS |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 1-(2,3-dichloro-4-methoxyphenyl)-2-methylsulfanylethanamine |
| SMILES | COc1ccc(C(N)CSC)c(Cl)c1Cl |
| InChI | InChI=1S/C10H13Cl2NOS/c1-14-8-4-3-6(7(13)5-15-2)9(11)10(8)12/h3-4,7H,5,13H2,1-2H3 |
| InChIKey | JLQGDHIWAXENQR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |