C13H20ClNO2 — CID 171221545
(1S)-1-(2-chloro-3,4-dimethoxyphenyl)-3-methylbutan-1-amine (PubChem CID 171221545) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is (1S)-1-(2-chloro-3,4-dimethoxyphenyl)-3-methylbutan-1-amine.
| Compound Name | (1S)-1-(2-chloro-3,4-dimethoxyphenyl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 171221545 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (1S)-1-(2-chloro-3,4-dimethoxyphenyl)-3-methylbutan-1-amine |
| SMILES | COc1ccc([C@@H](N)CC(C)C)c(Cl)c1OC |
| InChI | InChI=1S/C13H20ClNO2/c1-8(2)7-10(15)9-5-6-11(16-3)13(17-4)12(9)14/h5-6,8,10H,7,15H2,1-4H3/t10-/m0/s1 |
| InChIKey | PVPHUADYSURFAS-JTQLQIEISA-N |
| XLogP | 3.40 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |