C15H25NO3 — CID 171199872
(1R)-4-methyl-1-(2,3,4-trimethoxyphenyl)pentan-1-amine (PubChem CID 171199872) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (1R)-4-methyl-1-(2,3,4-trimethoxyphenyl)pentan-1-amine.
| Compound Name | (1R)-4-methyl-1-(2,3,4-trimethoxyphenyl)pentan-1-amine |
|---|---|
| PubChem CID | 171199872 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (1R)-4-methyl-1-(2,3,4-trimethoxyphenyl)pentan-1-amine |
| SMILES | COc1ccc([C@H](N)CCC(C)C)c(OC)c1OC |
| InChI | InChI=1S/C15H25NO3/c1-10(2)6-8-12(16)11-7-9-13(17-3)15(19-5)14(11)18-4/h7,9-10,12H,6,8,16H2,1-5H3/t12-/m1/s1 |
| InChIKey | PLPKHDYXNDCODH-GFCCVEGCSA-N |
| XLogP | 3.15 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |