C15H23NO5 — CID 62942194
5-amino-3-methyl-5-(2,3,4-trimethoxyphenyl)pentanoic acid (PubChem CID 62942194) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is 5-amino-3-methyl-5-(2,3,4-trimethoxyphenyl)pentanoic acid.
| Compound Name | 5-amino-3-methyl-5-(2,3,4-trimethoxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 62942194 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 5-amino-3-methyl-5-(2,3,4-trimethoxyphenyl)pentanoic acid |
| SMILES | COc1ccc(C(N)CC(C)CC(=O)O)c(OC)c1OC |
| InChI | InChI=1S/C15H23NO5/c1-9(8-13(17)18)7-11(16)10-5-6-12(19-2)15(21-4)14(10)20-3/h5-6,9,11H,7-8,16H2,1-4H3,(H,17,18) |
| InChIKey | OBEMYCRNKPBGSE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |