C14H20ClNO3 — CID 113425500
methyl 5-amino-5-(5-chloro-2-methoxyphenyl)-3-methylpentanoate (PubChem CID 113425500) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is methyl 5-amino-5-(5-chloro-2-methoxyphenyl)-3-methylpentanoate.
| Compound Name | methyl 5-amino-5-(5-chloro-2-methoxyphenyl)-3-methylpentanoate |
|---|---|
| PubChem CID | 113425500 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | methyl 5-amino-5-(5-chloro-2-methoxyphenyl)-3-methylpentanoate |
| SMILES | COC(=O)CC(C)CC(N)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C14H20ClNO3/c1-9(7-14(17)19-3)6-12(16)11-8-10(15)4-5-13(11)18-2/h4-5,8-9,12H,6-7,16H2,1-3H3 |
| InChIKey | UJMDRJFYALXWQL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |