C12H19ClN2O — CID 116948837
1-(5-chloro-2-methoxyphenyl)-1-N-methylbutane-1,3-diamine (PubChem CID 116948837) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-1-N-methylbutane-1,3-diamine.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-1-N-methylbutane-1,3-diamine |
|---|---|
| PubChem CID | 116948837 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-1-N-methylbutane-1,3-diamine |
| SMILES | CNC(CC(C)N)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C12H19ClN2O/c1-8(14)6-11(15-2)10-7-9(13)4-5-12(10)16-3/h4-5,7-8,11,15H,6,14H2,1-3H3 |
| InChIKey | ATEDPTXSIPAYFM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |