C10H14ClNOS — CID 116830604
2-(5-chloro-2-methoxyphenyl)-2-(methylamino)ethanethiol (PubChem CID 116830604) has the molecular formula C10H14ClNOS and a molecular weight of 231.75 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-2-(methylamino)ethanethiol.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-2-(methylamino)ethanethiol |
|---|---|
| PubChem CID | 116830604 |
| Molecular Formula | C10H14ClNOS |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-2-(methylamino)ethanethiol |
| SMILES | CNC(CS)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C10H14ClNOS/c1-12-9(6-14)8-5-7(11)3-4-10(8)13-2/h3-5,9,12,14H,6H2,1-2H3 |
| InChIKey | WINMDLXKJSZWRN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|