C10H13Cl2NOS — CID 116830702
2-(2,3-dichloro-4-methoxyphenyl)-2-(methylamino)ethanethiol (PubChem CID 116830702) has the molecular formula C10H13Cl2NOS and a molecular weight of 266.19 g/mol. Its IUPAC name is 2-(2,3-dichloro-4-methoxyphenyl)-2-(methylamino)ethanethiol.
| Compound Name | 2-(2,3-dichloro-4-methoxyphenyl)-2-(methylamino)ethanethiol |
|---|---|
| PubChem CID | 116830702 |
| Molecular Formula | C10H13Cl2NOS |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 2-(2,3-dichloro-4-methoxyphenyl)-2-(methylamino)ethanethiol |
| SMILES | CNC(CS)c1ccc(OC)c(Cl)c1Cl |
| InChI | InChI=1S/C10H13Cl2NOS/c1-13-7(5-15)6-3-4-8(14-2)10(12)9(6)11/h3-4,7,13,15H,5H2,1-2H3 |
| InChIKey | JRXTUWGZEVVVTK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|