C11H15Cl2NO2 — CID 116859359
2-(2,3-dichloro-4-methoxyphenyl)-2-(ethylamino)ethanol (PubChem CID 116859359) has the molecular formula C11H15Cl2NO2 and a molecular weight of 264.15 g/mol. Its IUPAC name is 2-(2,3-dichloro-4-methoxyphenyl)-2-(ethylamino)ethanol.
| Compound Name | 2-(2,3-dichloro-4-methoxyphenyl)-2-(ethylamino)ethanol |
|---|---|
| PubChem CID | 116859359 |
| Molecular Formula | C11H15Cl2NO2 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-(2,3-dichloro-4-methoxyphenyl)-2-(ethylamino)ethanol |
| SMILES | CCNC(CO)c1ccc(OC)c(Cl)c1Cl |
| InChI | InChI=1S/C11H15Cl2NO2/c1-3-14-8(6-15)7-4-5-9(16-2)11(13)10(7)12/h4-5,8,14-15H,3,6H2,1-2H3 |
| InChIKey | ILUSXCWMHHCZFF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |