C9H11ClFNS — CID 116830674
2-(5-chloro-2-fluorophenyl)-2-(methylamino)ethanethiol (PubChem CID 116830674) has the molecular formula C9H11ClFNS and a molecular weight of 219.71 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-2-(methylamino)ethanethiol.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-2-(methylamino)ethanethiol |
|---|---|
| PubChem CID | 116830674 |
| Molecular Formula | C9H11ClFNS |
| Molecular Weight | 219.71 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-2-(methylamino)ethanethiol |
| SMILES | CNC(CS)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C9H11ClFNS/c1-12-9(5-13)7-4-6(10)2-3-8(7)11/h2-4,9,12-13H,5H2,1H3 |
| InChIKey | XQERBLFWVCTTHV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.71 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|