C13H12Cl2FNS — CID 114886081
1-(5-chloro-2-fluorophenyl)-2-(5-chlorothiophen-2-yl)-N-methylethanamine (PubChem CID 114886081) has the molecular formula C13H12Cl2FNS and a molecular weight of 304.22 g/mol. Its IUPAC name is 1-(5-chloro-2-fluorophenyl)-2-(5-chlorothiophen-2-yl)-N-methylethanamine.
| Compound Name | 1-(5-chloro-2-fluorophenyl)-2-(5-chlorothiophen-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 114886081 |
| Molecular Formula | C13H12Cl2FNS |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 1-(5-chloro-2-fluorophenyl)-2-(5-chlorothiophen-2-yl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(Cl)s1)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C13H12Cl2FNS/c1-17-12(7-9-3-5-13(15)18-9)10-6-8(14)2-4-11(10)16/h2-6,12,17H,7H2,1H3 |
| InChIKey | FMQUVAAHCUVUHW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |