C10H13ClFNS — CID 116908834
2-(5-chloro-2-fluorophenyl)-2-(dimethylamino)ethanethiol (PubChem CID 116908834) has the molecular formula C10H13ClFNS and a molecular weight of 233.74 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-2-(dimethylamino)ethanethiol.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-2-(dimethylamino)ethanethiol |
|---|---|
| PubChem CID | 116908834 |
| Molecular Formula | C10H13ClFNS |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-2-(dimethylamino)ethanethiol |
| SMILES | CN(C)C(CS)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C10H13ClFNS/c1-13(2)10(6-14)8-5-7(11)3-4-9(8)12/h3-5,10,14H,6H2,1-2H3 |
| InChIKey | QTIBGPMQVXEYEY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|