C14H21NO5 — CID 64528349
3-(dimethylamino)-3-(2,3,4-trimethoxyphenyl)propanoic acid (PubChem CID 64528349) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 3-(dimethylamino)-3-(2,3,4-trimethoxyphenyl)propanoic acid.
| Compound Name | 3-(dimethylamino)-3-(2,3,4-trimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 64528349 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 3-(dimethylamino)-3-(2,3,4-trimethoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)N(C)C)c(OC)c1OC |
| InChI | InChI=1S/C14H21NO5/c1-15(2)10(8-12(16)17)9-6-7-11(18-3)14(20-5)13(9)19-4/h6-7,10H,8H2,1-5H3,(H,16,17) |
| InChIKey | XSZISMAFRYMQNL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |