C13H17NO6 — CID 78961815
(3R)-3-formamido-3-(2,3,4-trimethoxyphenyl)propanoic acid (PubChem CID 78961815) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is (3R)-3-formamido-3-(2,3,4-trimethoxyphenyl)propanoic acid.
| Compound Name | (3R)-3-formamido-3-(2,3,4-trimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 78961815 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (3R)-3-formamido-3-(2,3,4-trimethoxyphenyl)propanoic acid |
| SMILES | COc1ccc([C@@H](CC(=O)O)NC=O)c(OC)c1OC |
| InChI | InChI=1S/C13H17NO6/c1-18-10-5-4-8(12(19-2)13(10)20-3)9(14-7-15)6-11(16)17/h4-5,7,9H,6H2,1-3H3,(H,14,15)(H,16,17)/t9-/m1/s1 |
| InChIKey | HGFXXBNOZYVBON-SECBINFHSA-N |
| XLogP | 0.97 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|