C14H19NO6 — CID 43410447
3-[(2,3,4-trimethoxybenzoyl)amino]butanoic acid (PubChem CID 43410447) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is 3-[(2,3,4-trimethoxybenzoyl)amino]butanoic acid.
| Compound Name | 3-[(2,3,4-trimethoxybenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 43410447 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 3-[(2,3,4-trimethoxybenzoyl)amino]butanoic acid |
| SMILES | COc1ccc(C(=O)NC(C)CC(=O)O)c(OC)c1OC |
| InChI | InChI=1S/C14H19NO6/c1-8(7-11(16)17)15-14(18)9-5-6-10(19-2)13(21-4)12(9)20-3/h5-6,8H,7H2,1-4H3,(H,15,18)(H,16,17) |
| InChIKey | RCHZTAOTXDOGRG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |