C15H23NO5 — CID 115735137
N-(1-hydroxypentan-3-yl)-2,3,4-trimethoxybenzamide (PubChem CID 115735137) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is N-(1-hydroxypentan-3-yl)-2,3,4-trimethoxybenzamide.
| Compound Name | N-(1-hydroxypentan-3-yl)-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 115735137 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-(1-hydroxypentan-3-yl)-2,3,4-trimethoxybenzamide |
| SMILES | CCC(CCO)NC(=O)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C15H23NO5/c1-5-10(8-9-17)16-15(18)11-6-7-12(19-2)14(21-4)13(11)20-3/h6-7,10,17H,5,8-9H2,1-4H3,(H,16,18) |
| InChIKey | PCBJIRKAPSFVAT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |