C14H19NO6 — CID 60816133
ethyl 2-[(2,3,4-trimethoxybenzoyl)amino]acetate (PubChem CID 60816133) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is ethyl 2-[(2,3,4-trimethoxybenzoyl)amino]acetate.
| Compound Name | ethyl 2-[(2,3,4-trimethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 60816133 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | ethyl 2-[(2,3,4-trimethoxybenzoyl)amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C14H19NO6/c1-5-21-11(16)8-15-14(17)9-6-7-10(18-2)13(20-4)12(9)19-3/h6-7H,5,8H2,1-4H3,(H,15,17) |
| InChIKey | WOXGVHGKWIKCPP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |