C14H19NO5 — CID 47257630
ethyl 2-[(3-ethoxy-4-methoxybenzoyl)amino]acetate (PubChem CID 47257630) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is ethyl 2-[(3-ethoxy-4-methoxybenzoyl)amino]acetate.
| Compound Name | ethyl 2-[(3-ethoxy-4-methoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 47257630 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | ethyl 2-[(3-ethoxy-4-methoxybenzoyl)amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1ccc(OC)c(OCC)c1 |
| InChI | InChI=1S/C14H19NO5/c1-4-19-12-8-10(6-7-11(12)18-3)14(17)15-9-13(16)20-5-2/h6-8H,4-5,9H2,1-3H3,(H,15,17) |
| InChIKey | LTTMKMFNVBDDJF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |