C15H22N2O7S — CID 7618819
ethyl 2-[2-[(3,4-dimethoxybenzoyl)amino]ethylsulfonylamino]acetate (PubChem CID 7618819) has the molecular formula C15H22N2O7S and a molecular weight of 374.42 g/mol. Its IUPAC name is ethyl 2-[2-[(3,4-dimethoxybenzoyl)amino]ethylsulfonylamino]acetate.
| Compound Name | ethyl 2-[2-[(3,4-dimethoxybenzoyl)amino]ethylsulfonylamino]acetate |
|---|---|
| PubChem CID | 7618819 |
| Molecular Formula | C15H22N2O7S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | ethyl 2-[2-[(3,4-dimethoxybenzoyl)amino]ethylsulfonylamino]acetate |
| SMILES | CCOC(=O)CNS(=O)(=O)CCNC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O7S/c1-4-24-14(18)10-17-25(20,21)8-7-16-15(19)11-5-6-12(22-2)13(9-11)23-3/h5-6,9,17H,4,7-8,10H2,1-3H3,(H,16,19) |
| InChIKey | AIXMHHLXBIJDRC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |