C18H29N3O6S — CID 7618847
3,4-dimethoxy-N-[2-(3-morpholin-4-ylpropylsulfamoyl)ethyl]benzamide (PubChem CID 7618847) has the molecular formula C18H29N3O6S and a molecular weight of 415.51 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-(3-morpholin-4-ylpropylsulfamoyl)ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-(3-morpholin-4-ylpropylsulfamoyl)ethyl]benzamide |
|---|---|
| PubChem CID | 7618847 |
| Molecular Formula | C18H29N3O6S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3,4-dimethoxy-N-[2-(3-morpholin-4-ylpropylsulfamoyl)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCS(=O)(=O)NCCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C18H29N3O6S/c1-25-16-5-4-15(14-17(16)26-2)18(22)19-7-13-28(23,24)20-6-3-8-21-9-11-27-12-10-21/h4-5,14,20H,3,6-13H2,1-2H3,(H,19,22) |
| InChIKey | CULIZYIZLVQBRY-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|