C17H25BrN2O4 — CID 55742240
4-bromo-3,5-dimethoxy-N-(4-morpholin-4-ylbutyl)benzamide (PubChem CID 55742240) has the molecular formula C17H25BrN2O4 and a molecular weight of 401.30 g/mol. Its IUPAC name is 4-bromo-3,5-dimethoxy-N-(4-morpholin-4-ylbutyl)benzamide.
| Compound Name | 4-bromo-3,5-dimethoxy-N-(4-morpholin-4-ylbutyl)benzamide |
|---|---|
| PubChem CID | 55742240 |
| Molecular Formula | C17H25BrN2O4 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 4-bromo-3,5-dimethoxy-N-(4-morpholin-4-ylbutyl)benzamide |
| SMILES | COc1cc(C(=O)NCCCCN2CCOCC2)cc(OC)c1Br |
| InChI | InChI=1S/C17H25BrN2O4/c1-22-14-11-13(12-15(23-2)16(14)18)17(21)19-5-3-4-6-20-7-9-24-10-8-20/h11-12H,3-10H2,1-2H3,(H,19,21) |
| InChIKey | CPJVYOMSCOLURE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|