methyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate

C16H22N2O4 — CID 108786662

IUPACmethyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate
SMILESCOC(=O)c1cccc(C(=O)NCCCN2CCOCC2)c1
InChIInChI=1S/C16H22N2O4/c1-21-16(20)14-5-2-4-13(12-14)15(19)17-6-3-7-18-8-10-22-11-9-18/h2,4-5,12H,3,6-11H2,1H3,(H,17,19)
InChIKeyYYNOWRAPGSFUHC-UHFFFAOYSA-N
MW306.36 g/mol
LogP0.93
Rot. Bonds6

About methyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate

methyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate (PubChem CID 108786662) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is methyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate.

Molecular Properties

Compound Namemethyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate
PubChem CID108786662
Molecular FormulaC16H22N2O4
Molecular Weight306.36 g/mol
Exact Mass306.16
IUPAC Namemethyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate
SMILESCOC(=O)c1cccc(C(=O)NCCCN2CCOCC2)c1
InChIInChI=1S/C16H22N2O4/c1-21-16(20)14-5-2-4-13(12-14)15(19)17-6-3-7-18-8-10-22-11-9-18/h2,4-5,12H,3,6-11H2,1H3,(H,17,19)
InChIKeyYYNOWRAPGSFUHC-UHFFFAOYSA-N
XLogP0.93
TPSA67.87 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.36
LogP ≤ 50.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate?
The IUPAC name of methyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate (CID 108786662) is methyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate.
What is the SMILES notation for methyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate?
The canonical SMILES for methyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate is COC(=O)c1cccc(C(=O)NCCCN2CCOCC2)c1.
What is the InChIKey of methyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate?
The InChIKey is YYNOWRAPGSFUHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O4/c1-21-16(20)14-5-2-4-13(12-14)15(19)17-6-3-7-18-8-10-22-11-9-18/h2,4-5,12H,3,6-11H2,1H3,(H,17,19).
What are the key properties of methyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate?
methyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate has a molecular weight of 306.36 g/mol, XLogP of 0.93, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-morpholin-4-ylpropylcarbamoyl)benzoate is sourced from PubChem (CID 108786662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).