C20H25N5O3 — CID 55824435
methyl 3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propylcarbamoyl]benzoate (PubChem CID 55824435) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is methyl 3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propylcarbamoyl]benzoate.
| Compound Name | methyl 3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 55824435 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | methyl 3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propylcarbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NCCCN2CCN(c3ncccn3)CC2)c1 |
| InChI | InChI=1S/C20H25N5O3/c1-28-19(27)17-6-2-5-16(15-17)18(26)21-9-4-10-24-11-13-25(14-12-24)20-22-7-3-8-23-20/h2-3,5-8,15H,4,9-14H2,1H3,(H,21,26) |
| InChIKey | NZWIIDSHDXTJMY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|