C18H24N6O2 — CID 39541853
2-methoxy-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyridine-3-carboxamide (PubChem CID 39541853) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-methoxy-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyridine-3-carboxamide.
| Compound Name | 2-methoxy-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 39541853 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 2-methoxy-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyridine-3-carboxamide |
| SMILES | COc1ncccc1C(=O)NCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H24N6O2/c1-26-17-15(5-2-6-20-17)16(25)19-9-4-10-23-11-13-24(14-12-23)18-21-7-3-8-22-18/h2-3,5-8H,4,9-14H2,1H3,(H,19,25) |
| InChIKey | ZDEFGUDSPJWZAT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|