C19H24N6O4 — CID 31413812
2-methoxy-5-nitro-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide (PubChem CID 31413812) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-methoxy-5-nitro-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 2-methoxy-5-nitro-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 31413812 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-methoxy-5-nitro-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)NCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H24N6O4/c1-29-17-5-4-15(25(27)28)14-16(17)18(26)20-8-3-9-23-10-12-24(13-11-23)19-21-6-2-7-22-19/h2,4-7,14H,3,8-13H2,1H3,(H,20,26) |
| InChIKey | SCSRJHUQRXQVCH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|