C15H23ClN4O4 — CID 119394311
2-methoxy-5-nitro-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride (PubChem CID 119394311) has the molecular formula C15H23ClN4O4 and a molecular weight of 358.83 g/mol. Its IUPAC name is 2-methoxy-5-nitro-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride.
| Compound Name | 2-methoxy-5-nitro-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119394311 |
| Molecular Formula | C15H23ClN4O4 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-methoxy-5-nitro-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)NCCCN1CCNCC1.Cl |
| InChI | InChI=1S/C15H22N4O4.ClH/c1-23-14-4-3-12(19(21)22)11-13(14)15(20)17-5-2-8-18-9-6-16-7-10-18;/h3-4,11,16H,2,5-10H2,1H3,(H,17,20);1H |
| InChIKey | XYNBKAQCHFHBSA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|