C15H21ClN6O3 — CID 119391354
5-nitro-N-(3-piperazin-1-ylpropyl)-1H-indazole-3-carboxamide;hydrochloride (PubChem CID 119391354) has the molecular formula C15H21ClN6O3 and a molecular weight of 368.83 g/mol. Its IUPAC name is 5-nitro-N-(3-piperazin-1-ylpropyl)-1H-indazole-3-carboxamide;hydrochloride.
| Compound Name | 5-nitro-N-(3-piperazin-1-ylpropyl)-1H-indazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119391354 |
| Molecular Formula | C15H21ClN6O3 |
| Molecular Weight | 368.83 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 5-nitro-N-(3-piperazin-1-ylpropyl)-1H-indazole-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCN1CCNCC1)c1n[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C15H20N6O3.ClH/c22-15(17-4-1-7-20-8-5-16-6-9-20)14-12-10-11(21(23)24)2-3-13(12)18-19-14;/h2-3,10,16H,1,4-9H2,(H,17,22)(H,18,19);1H |
| InChIKey | CGQQFLCZAUZGDM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.83 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|