C15H17F3N6O3 — CID 120811569
5-nitro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)-1H-indazole-3-carboxamide (PubChem CID 120811569) has the molecular formula C15H17F3N6O3 and a molecular weight of 386.33 g/mol. Its IUPAC name is 5-nitro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)-1H-indazole-3-carboxamide.
| Compound Name | 5-nitro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 120811569 |
| Molecular Formula | C15H17F3N6O3 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 5-nitro-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)-1H-indazole-3-carboxamide |
| SMILES | O=C(NCC(N1CCNCC1)C(F)(F)F)c1n[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C15H17F3N6O3/c16-15(17,18)12(23-5-3-19-4-6-23)8-20-14(25)13-10-7-9(24(26)27)1-2-11(10)21-22-13/h1-2,7,12,19H,3-6,8H2,(H,20,25)(H,21,22) |
| InChIKey | JDORVZGKNNXDQY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|