C11H12N4O4 — CID 78856338
N-(1-hydroxypropan-2-yl)-5-nitro-1H-indazole-3-carboxamide (PubChem CID 78856338) has the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-5-nitro-1H-indazole-3-carboxamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-5-nitro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 78856338 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-5-nitro-1H-indazole-3-carboxamide |
| SMILES | CC(CO)NC(=O)c1n[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C11H12N4O4/c1-6(5-16)12-11(17)10-8-4-7(15(18)19)2-3-9(8)13-14-10/h2-4,6,16H,5H2,1H3,(H,12,17)(H,13,14) |
| InChIKey | GRQZLVZRDPZZHS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|